C9H15NO3 — CID 167008611
4-methoxy-3-propan-2-ylpiperidine-2,6-dione (PubChem CID 167008611) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 4-methoxy-3-propan-2-ylpiperidine-2,6-dione.
| Compound Name | 4-methoxy-3-propan-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 167008611 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 4-methoxy-3-propan-2-ylpiperidine-2,6-dione |
| SMILES | COC1CC(=O)NC(=O)C1C(C)C |
| InChI | InChI=1S/C9H15NO3/c1-5(2)8-6(13-3)4-7(11)10-9(8)12/h5-6,8H,4H2,1-3H3,(H,10,11,12) |
| InChIKey | RHEHRBJQRFMGPP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|