C14H19NO4S — CID 167009225
3-(2-propylmorpholin-4-yl)sulfonylbenzaldehyde (PubChem CID 167009225) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(2-propylmorpholin-4-yl)sulfonylbenzaldehyde.
| Compound Name | 3-(2-propylmorpholin-4-yl)sulfonylbenzaldehyde |
|---|---|
| PubChem CID | 167009225 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(2-propylmorpholin-4-yl)sulfonylbenzaldehyde |
| SMILES | CCCC1CN(S(=O)(=O)c2cccc(C=O)c2)CCO1 |
| InChI | InChI=1S/C14H19NO4S/c1-2-4-13-10-15(7-8-19-13)20(17,18)14-6-3-5-12(9-14)11-16/h3,5-6,9,11,13H,2,4,7-8,10H2,1H3 |
| InChIKey | XHSPDOHHLQVIRZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|