C22H24F3N4O3S- — CID 167009596
CID 167009596 (PubChem CID 167009596) has the molecular formula C22H24F3N4O3S- and a molecular weight of 481.52 g/mol.
| Compound Name | CID 167009596 |
|---|---|
| PubChem CID | 167009596 |
| Molecular Formula | C22H24F3N4O3S- |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(C(=O)Nc2cccc(OCCC(F)(F)F)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C22H24F3N4O3S/c23-22(24,25)10-13-32-19-3-1-2-18(27-19)28-20(30)16-5-4-15(33(26)31)14-17(16)29-11-8-21(6-7-21)9-12-29/h1-5,14,26H,6-13H2,(H,27,28,30)/q-1 |
| InChIKey | NZDUCASJFHJLJB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|