C8H13N3 — CID 167009720
N'-methyl-N-(5-methylidene-3,4-dihydro-2H-pyridin-6-yl)methanimidamide (PubChem CID 167009720) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N'-methyl-N-(5-methylidene-3,4-dihydro-2H-pyridin-6-yl)methanimidamide.
| Compound Name | N'-methyl-N-(5-methylidene-3,4-dihydro-2H-pyridin-6-yl)methanimidamide |
|---|---|
| PubChem CID | 167009720 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N'-methyl-N-(5-methylidene-3,4-dihydro-2H-pyridin-6-yl)methanimidamide |
| SMILES | C=C1CCCN=C1N/C=N/C |
| InChI | InChI=1S/C8H13N3/c1-7-4-3-5-10-8(7)11-6-9-2/h6H,1,3-5H2,2H3,(H,9,10,11) |
| InChIKey | JKLNBCVRAYAPIE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|