About 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one
6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one (PubChem CID 167009754) has the molecular formula C9H16N2O2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one.
Molecular Properties
| Compound Name | 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one |
| PubChem CID | 167009754 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one |
| SMILES | O=C1CCCC(C2CNCCS2=O)N1 |
| InChI | InChI=1S/C9H16N2O2S/c12-9-3-1-2-7(11-9)8-6-10-4-5-14(8)13/h7-8,10H,1-6H2,(H,11,12) |
| InChIKey | GZOQNEZXQZHYAR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one?
The IUPAC name of 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one (CID 167009754) is 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one.
What is the SMILES notation for 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one?
The canonical SMILES for 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one is O=C1CCCC(C2CNCCS2=O)N1.
What is the InChIKey of 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one?
The InChIKey is GZOQNEZXQZHYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S/c12-9-3-1-2-7(11-9)8-6-10-4-5-14(8)13/h7-8,10H,1-6H2,(H,11,12).
What are the key properties of 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one?
6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one has a molecular weight of 216.31 g/mol, XLogP of -0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-oxo-1,4-thiazinan-2-yl)piperidin-2-one is sourced from PubChem (CID 167009754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).