C34H38N6O2S — CID 167013116
11-(cyclopropyloxymethyl)-6-(2,6-dimethylphenyl)-12-[(6-pyrrolidin-1-ylpyrazin-2-yl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene (PubChem CID 167013116) has the molecular formula C34H38N6O2S and a molecular weight of 594.79 g/mol. Its IUPAC name is 11-(cyclopropyloxymethyl)-6-(2,6-dimethylphenyl)-12-[(6-pyrrolidin-1-ylpyrazin-2-yl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene.
| Compound Name | 11-(cyclopropyloxymethyl)-6-(2,6-dimethylphenyl)-12-[(6-pyrrolidin-1-ylpyrazin-2-yl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 167013116 |
| Molecular Formula | C34H38N6O2S |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 11-(cyclopropyloxymethyl)-6-(2,6-dimethylphenyl)-12-[(6-pyrrolidin-1-ylpyrazin-2-yl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(Cc1cncc(N3CCCC3)n1)C(COC1CC1)CO2 |
| InChI | InChI=1S/C34H38N6O2S/c1-22-7-5-8-23(2)33(22)30-17-32-38-34(37-30)39-43-28-10-6-9-24(15-28)29(25(21-42-32)20-41-27-11-12-27)16-26-18-35-19-31(36-26)40-13-3-4-14-40/h5-10,15,17-19,25,27,29H,3-4,11-14,16,20-21H2,1-2H3,(H,37,38,39) |
| InChIKey | FMWBGSXXRGPODX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|