C12H12N4OS2 — CID 167013145
8-(cyclopropylmethyl)-4-methyl-12-sulfanylidene-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one (PubChem CID 167013145) has the molecular formula C12H12N4OS2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-4-methyl-12-sulfanylidene-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one.
| Compound Name | 8-(cyclopropylmethyl)-4-methyl-12-sulfanylidene-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 167013145 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 8-(cyclopropylmethyl)-4-methyl-12-sulfanylidene-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one |
| SMILES | Cc1cc2c(s1)c(=O)n(CC1CC1)c1n[nH]c(=S)n21 |
| InChI | InChI=1S/C12H12N4OS2/c1-6-4-8-9(19-6)10(17)15(5-7-2-3-7)11-13-14-12(18)16(8)11/h4,7H,2-3,5H2,1H3,(H,14,18) |
| InChIKey | DFINZXWRXQZHSU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|