C22H19F2N5O6 — CID 167013275
4-[2-[4-carboxy-2-fluoro-5-[[(Z,5E)-2-imino-5-(iminohydrazinylidene)pent-3-enoyl]amino]phenoxy]ethyl]-5-fluoro-2-methylbenzoic acid (PubChem CID 167013275) has the molecular formula C22H19F2N5O6 and a molecular weight of 487.42 g/mol. Its IUPAC name is 4-[2-[4-carboxy-2-fluoro-5-[[(Z,5E)-2-imino-5-(iminohydrazinylidene)pent-3-enoyl]amino]phenoxy]ethyl]-5-fluoro-2-methylbenzoic acid.
| Compound Name | 4-[2-[4-carboxy-2-fluoro-5-[[(Z,5E)-2-imino-5-(iminohydrazinylidene)pent-3-enoyl]amino]phenoxy]ethyl]-5-fluoro-2-methylbenzoic acid |
|---|---|
| PubChem CID | 167013275 |
| Molecular Formula | C22H19F2N5O6 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[2-[4-carboxy-2-fluoro-5-[[(Z,5E)-2-imino-5-(iminohydrazinylidene)pent-3-enoyl]amino]phenoxy]ethyl]-5-fluoro-2-methylbenzoic acid |
| SMILES | [H]/N=N/N=C/C=C\C(=N/[H])C(=O)Nc1cc(OCCc2cc(C)c(C(=O)O)cc2F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C22H19F2N5O6/c1-11-7-12(15(23)8-13(11)21(31)32)4-6-35-19-10-18(14(22(33)34)9-16(19)24)28-20(30)17(25)3-2-5-27-29-26/h2-3,5,7-10,25-26H,4,6H2,1H3,(H,28,30)(H,31,32)(H,33,34)/b3-2-,25-17+,27-5+,29-26+ |
| InChIKey | MAMVMBVJZIKYNZ-OLGHYCLXSA-N |
| XLogP | 3.82 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|