C13H15N3O3 — CID 167013292
N-(4-ethylphenyl)-2,6-dioxo-1,3-diazinane-4-carboxamide (PubChem CID 167013292) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2,6-dioxo-1,3-diazinane-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2,6-dioxo-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 167013292 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(4-ethylphenyl)-2,6-dioxo-1,3-diazinane-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CC(=O)NC(=O)N2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-8-3-5-9(6-4-8)14-12(18)10-7-11(17)16-13(19)15-10/h3-6,10H,2,7H2,1H3,(H,14,18)(H2,15,16,17,19) |
| InChIKey | AEIQEMSIFPFWHR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |