C17H33N — CID 167013475
(Z,5E)-5-ethylidene-N,N,2,6,7,8-hexamethylnon-3-en-2-amine (PubChem CID 167013475) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-N,N,2,6,7,8-hexamethylnon-3-en-2-amine.
| Compound Name | (Z,5E)-5-ethylidene-N,N,2,6,7,8-hexamethylnon-3-en-2-amine |
|---|---|
| PubChem CID | 167013475 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (Z,5E)-5-ethylidene-N,N,2,6,7,8-hexamethylnon-3-en-2-amine |
| SMILES | C/C=C(\C=C/C(C)(C)N(C)C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C17H33N/c1-10-16(15(5)14(4)13(2)3)11-12-17(6,7)18(8)9/h10-15H,1-9H3/b12-11-,16-10+ |
| InChIKey | ZYBGTEQGRWPEBD-GZQRZBQGSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|