C31H38F3N5O4S — CID 167013869
3-acetyl-N-[4-(2,6-dimethylphenyl)-6-[[(3S,6S)-3-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-1,4-diazepan-6-yl]oxy]pyrimidin-2-yl]benzenesulfonamide (PubChem CID 167013869) has the molecular formula C31H38F3N5O4S and a molecular weight of 633.74 g/mol. Its IUPAC name is 3-acetyl-N-[4-(2,6-dimethylphenyl)-6-[[(3S,6S)-3-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-1,4-diazepan-6-yl]oxy]pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[4-(2,6-dimethylphenyl)-6-[[(3S,6S)-3-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-1,4-diazepan-6-yl]oxy]pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 167013869 |
| Molecular Formula | C31H38F3N5O4S |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | 3-acetyl-N-[4-(2,6-dimethylphenyl)-6-[[(3S,6S)-3-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-1,4-diazepan-6-yl]oxy]pyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)Nc2nc(O[C@H]3CN[C@@H](CC(C)C)CN(CC(F)(F)F)C3)cc(-c3c(C)cccc3C)n2)c1 |
| InChI | InChI=1S/C31H38F3N5O4S/c1-19(2)12-24-16-39(18-31(32,33)34)17-25(15-35-24)43-28-14-27(29-20(3)8-6-9-21(29)4)36-30(37-28)38-44(41,42)26-11-7-10-23(13-26)22(5)40/h6-11,13-14,19,24-25,35H,12,15-18H2,1-5H3,(H,36,37,38)/t24-,25-/m0/s1 |
| InChIKey | VFGUGELXMPGPCH-DQEYMECFSA-N |
| XLogP | 5.39 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |