C30H39N5OS — CID 167013918
2-[[3-[4-(3,3-dimethylcyclopentyl)-1,4-diazepan-1-yl]phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one (PubChem CID 167013918) has the molecular formula C30H39N5OS and a molecular weight of 517.74 g/mol. Its IUPAC name is 2-[[3-[4-(3,3-dimethylcyclopentyl)-1,4-diazepan-1-yl]phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[3-[4-(3,3-dimethylcyclopentyl)-1,4-diazepan-1-yl]phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 167013918 |
| Molecular Formula | C30H39N5OS |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2-[[3-[4-(3,3-dimethylcyclopentyl)-1,4-diazepan-1-yl]phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one |
| SMILES | Cc1cccc(C)c1-c1cc(=O)[nH]c(NSc2cccc(N3CCCN(C4CCC(C)(C)C4)CC3)c2)n1 |
| InChI | InChI=1S/C30H39N5OS/c1-21-8-5-9-22(2)28(21)26-19-27(36)32-29(31-26)33-37-25-11-6-10-23(18-25)34-14-7-15-35(17-16-34)24-12-13-30(3,4)20-24/h5-6,8-11,18-19,24H,7,12-17,20H2,1-4H3,(H2,31,32,33,36) |
| InChIKey | YVFOSRHJASFXNP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|