C21H30O2 — CID 167014020
(4S,5S,8R)-4,8,12-trimethyl-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-10-ol (PubChem CID 167014020) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4S,5S,8R)-4,8,12-trimethyl-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-10-ol.
| Compound Name | (4S,5S,8R)-4,8,12-trimethyl-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-10-ol |
|---|---|
| PubChem CID | 167014020 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4S,5S,8R)-4,8,12-trimethyl-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-10-ol |
| SMILES | CC(C)=CCC[C@]1(C)COc2c(C)cc(O)c3c2[C@H]1CC[C@H]3C |
| InChI | InChI=1S/C21H30O2/c1-13(2)7-6-10-21(5)12-23-20-15(4)11-17(22)18-14(3)8-9-16(21)19(18)20/h7,11,14,16,22H,6,8-10,12H2,1-5H3/t14-,16-,21-/m1/s1 |
| InChIKey | VFRHCCPVTVFPRE-IUSZMWJPSA-N |
| XLogP | 5.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|