C31H38ClN9S — CID 167014300
2-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 167014300) has the molecular formula C31H38ClN9S and a molecular weight of 604.23 g/mol. Its IUPAC name is 2-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167014300 |
| Molecular Formula | C31H38ClN9S |
| Molecular Weight | 604.23 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 2-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CSN1CCc2cccc(Nc3nc(Nc4ccc(N5CCC(N6CCN(C)CC6)CC5)c(Cl)c4)nc4[nH]ccc34)c21 |
| InChI | InChI=1S/C31H38ClN9S/c1-38-16-18-39(19-17-38)23-10-13-40(14-11-23)27-7-6-22(20-25(27)32)34-31-36-29-24(8-12-33-29)30(37-31)35-26-5-3-4-21-9-15-41(42-2)28(21)26/h3-8,12,20,23H,9-11,13-19H2,1-2H3,(H3,33,34,35,36,37) |
| InChIKey | JZAJDBQIRMSZOR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.23 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|