C30H38N8O3S — CID 167014315
2-N-[2-methoxy-5-methyl-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-N-(1-methylsulfonyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 167014315) has the molecular formula C30H38N8O3S and a molecular weight of 590.75 g/mol. Its IUPAC name is 2-N-[2-methoxy-5-methyl-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-N-(1-methylsulfonyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-methoxy-5-methyl-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-N-(1-methylsulfonyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167014315 |
| Molecular Formula | C30H38N8O3S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 2-N-[2-methoxy-5-methyl-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-N-(1-methylsulfonyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2C[C@@H](C)N(C)[C@@H](C)C2)c(C)cc1Nc1nc(Nc2cccc3c2N(S(C)(=O)=O)CC3)c2cc[nH]c2n1 |
| InChI | InChI=1S/C30H38N8O3S/c1-18-14-24(26(41-5)15-25(18)37-16-19(2)36(4)20(3)17-37)33-30-34-28-22(10-12-31-28)29(35-30)32-23-9-7-8-21-11-13-38(27(21)23)42(6,39)40/h7-10,12,14-15,19-20H,11,13,16-17H2,1-6H3,(H3,31,32,33,34,35)/t19-,20+ |
| InChIKey | IXKAYRJCPXWXKM-BGYRXZFFSA-N |
| XLogP | 4.61 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |