About 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine
1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine (PubChem CID 167014557) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 167014557 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(N)c3c2OCO3)CC1 |
| InChI | InChI=1S/C14H21N3O2/c1-16(2)10-5-7-17(8-6-10)12-4-3-11(15)13-14(12)19-9-18-13/h3-4,10H,5-9,15H2,1-2H3 |
| InChIKey | LPTMQKHFJRFAKU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine (CID 167014557) is 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine is CN(C)C1CCN(c2ccc(N)c3c2OCO3)CC1.
What is the InChIKey of 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine?
The InChIKey is LPTMQKHFJRFAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-16(2)10-5-7-17(8-6-10)12-4-3-11(15)13-14(12)19-9-18-13/h3-4,10H,5-9,15H2,1-2H3.
What are the key properties of 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine?
1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine has a molecular weight of 263.34 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-amino-1,3-benzodioxol-4-yl)-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 167014557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).