(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid

C6H7NO3S — CID 167014789

IUPAC(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid
SMILESCO[C@H](C(=O)O)c1cscn1
InChIInChI=1S/C6H7NO3S/c1-10-5(6(8)9)4-2-11-3-7-4/h2-3,5H,1H3,(H,8,9)/t5-/m0/s1
InChIKeyQJEGEPYWJULNTH-YFKPBYRVSA-N
MW173.19 g/mol
LogP0.92
Rot. Bonds3

About (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid

(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid (PubChem CID 167014789) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid
PubChem CID167014789
Molecular FormulaC6H7NO3S
Molecular Weight173.19 g/mol
Exact Mass173.01
IUPAC Name(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid
SMILESCO[C@H](C(=O)O)c1cscn1
InChIInChI=1S/C6H7NO3S/c1-10-5(6(8)9)4-2-11-3-7-4/h2-3,5H,1H3,(H,8,9)/t5-/m0/s1
InChIKeyQJEGEPYWJULNTH-YFKPBYRVSA-N
XLogP0.92
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.19
LogP ≤ 50.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The IUPAC name of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid (CID 167014789) is (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid is CO[C@H](C(=O)O)c1cscn1.
What is the InChIKey of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The InChIKey is QJEGEPYWJULNTH-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H7NO3S/c1-10-5(6(8)9)4-2-11-3-7-4/h2-3,5H,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid has a molecular weight of 173.19 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 167014789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).