About (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid
(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid (PubChem CID 167014789) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid.
Molecular Properties
| Compound Name | (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid |
| PubChem CID | 167014789 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid |
| SMILES | CO[C@H](C(=O)O)c1cscn1 |
| InChI | InChI=1S/C6H7NO3S/c1-10-5(6(8)9)4-2-11-3-7-4/h2-3,5H,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | QJEGEPYWJULNTH-YFKPBYRVSA-N |
| XLogP | 0.92 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The IUPAC name of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid (CID 167014789) is (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid is CO[C@H](C(=O)O)c1cscn1.
What is the InChIKey of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
The InChIKey is QJEGEPYWJULNTH-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H7NO3S/c1-10-5(6(8)9)4-2-11-3-7-4/h2-3,5H,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid?
(2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid has a molecular weight of 173.19 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methoxy-2-(1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 167014789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).