About 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid
6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid (PubChem CID 167015805) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid.
Analyze 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid?
The IUPAC name of 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid (CID 167015805) is 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid is CC1CC=CN1c1ccc(C(=O)O)cn1.
What is the InChIKey of 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid?
The InChIKey is KAOYRGDUHXVYNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-8-3-2-6-13(8)10-5-4-9(7-12-10)11(14)15/h2,4-8H,3H2,1H3,(H,14,15).
What are the key properties of 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid?
6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid has a molecular weight of 204.23 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-2,3-dihydropyrrol-1-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 167015805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).