C14H21N3 — CID 167017040
2-[(1Z,5Z)-5-methyl-3-methylidene-4-propan-2-ylideneocta-1,5,7-trienyl]guanidine (PubChem CID 167017040) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[(1Z,5Z)-5-methyl-3-methylidene-4-propan-2-ylideneocta-1,5,7-trienyl]guanidine.
| Compound Name | 2-[(1Z,5Z)-5-methyl-3-methylidene-4-propan-2-ylideneocta-1,5,7-trienyl]guanidine |
|---|---|
| PubChem CID | 167017040 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2-[(1Z,5Z)-5-methyl-3-methylidene-4-propan-2-ylideneocta-1,5,7-trienyl]guanidine |
| SMILES | C=C/C=C(/C)C(C(=C)/C=C\N=C(N)N)=C(C)C |
| InChI | InChI=1S/C14H21N3/c1-6-7-11(4)13(10(2)3)12(5)8-9-17-14(15)16/h6-9H,1,5H2,2-4H3,(H4,15,16,17)/b9-8-,11-7- |
| InChIKey | HMIYDYHYTYJVJG-VVPOTFPNSA-N |
| XLogP | 2.80 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|