About tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate
tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate (PubChem CID 167017306) has the molecular formula C21H28ClN3O3
and a molecular weight of 405.93 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate |
| PubChem CID | 167017306 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate |
| SMILES | Cc1cccc(C)c1-c1nc(N(C)C(=O)OC(C)(C)C)nc(Cl)c1OC(C)C |
| InChI | InChI=1S/C21H28ClN3O3/c1-12(2)27-17-16(15-13(3)10-9-11-14(15)4)23-19(24-18(17)22)25(8)20(26)28-21(5,6)7/h9-12H,1-8H3 |
| InChIKey | KKCILZVRUINYJW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate (CID 167017306) is tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate is Cc1cccc(C)c1-c1nc(N(C)C(=O)OC(C)(C)C)nc(Cl)c1OC(C)C.
What is the InChIKey of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate?
The InChIKey is KKCILZVRUINYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28ClN3O3/c1-12(2)27-17-16(15-13(3)10-9-11-14(15)4)23-19(24-18(17)22)25(8)20(26)28-21(5,6)7/h9-12H,1-8H3.
What are the key properties of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate?
tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate has a molecular weight of 405.93 g/mol, XLogP of 5.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)-5-propan-2-yloxypyrimidin-2-yl]-N-methylcarbamate is sourced from PubChem (CID 167017306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).