C23H23FN3O4P — CID 167017720
(19S)-19-ethyl-6-fluoro-19-hydroxy-10-[2-(methylamino)ethyl]-7-phosphanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 167017720) has the molecular formula C23H23FN3O4P and a molecular weight of 455.43 g/mol. Its IUPAC name is (19S)-19-ethyl-6-fluoro-19-hydroxy-10-[2-(methylamino)ethyl]-7-phosphanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-6-fluoro-19-hydroxy-10-[2-(methylamino)ethyl]-7-phosphanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 167017720 |
| Molecular Formula | C23H23FN3O4P |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (19S)-19-ethyl-6-fluoro-19-hydroxy-10-[2-(methylamino)ethyl]-7-phosphanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(P)cc1c2CCNC |
| InChI | InChI=1S/C23H23FN3O4P/c1-3-23(30)15-7-18-20-13(9-27(18)21(28)14(15)10-31-22(23)29)11(4-5-25-2)12-6-19(32)16(24)8-17(12)26-20/h6-8,25,30H,3-5,9-10,32H2,1-2H3/t23-/m0/s1 |
| InChIKey | FSLQWKRWJPSXGW-QHCPKHFHSA-N |
| XLogP | 1.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|