C31H31FN6O2 — CID 167017755
N-[(2R,3S)-1-[1-(4-fluorophenyl)indazol-5-yl]-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4,4-dimethyl-5-oxopyrrolidin-3-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 167017755) has the molecular formula C31H31FN6O2 and a molecular weight of 538.63 g/mol. Its IUPAC name is N-[(2R,3S)-1-[1-(4-fluorophenyl)indazol-5-yl]-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4,4-dimethyl-5-oxopyrrolidin-3-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(2R,3S)-1-[1-(4-fluorophenyl)indazol-5-yl]-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4,4-dimethyl-5-oxopyrrolidin-3-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167017755 |
| Molecular Formula | C31H31FN6O2 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-[(2R,3S)-1-[1-(4-fluorophenyl)indazol-5-yl]-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4,4-dimethyl-5-oxopyrrolidin-3-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1[C@@H](NC(=O)c2ccn(C)n2)C(C)(C)C(=O)N1c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C31H31FN6O2/c1-6-7-8-9-20(2)27-28(34-29(39)25-16-17-36(5)35-25)31(3,4)30(40)37(27)24-14-15-26-21(18-24)19-33-38(26)23-12-10-22(32)11-13-23/h6-19,27-28H,2H2,1,3-5H3,(H,34,39)/b7-6-,9-8-/t27-,28-/m1/s1 |
| InChIKey | SDXDIOCHJNLVCB-WYXNIHNBSA-N |
| XLogP | 5.13 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|