C18H26N6O4S — CID 167018824
(2R)-2-amino-N-[[(6S)-6-(anilinocarbamoyl)-4-oxo-8a-sulfanyl-3,6,7,8-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazin-3-yl]methyl]-2-(methylamino)acetamide (PubChem CID 167018824) has the molecular formula C18H26N6O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is (2R)-2-amino-N-[[(6S)-6-(anilinocarbamoyl)-4-oxo-8a-sulfanyl-3,6,7,8-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazin-3-yl]methyl]-2-(methylamino)acetamide.
| Compound Name | (2R)-2-amino-N-[[(6S)-6-(anilinocarbamoyl)-4-oxo-8a-sulfanyl-3,6,7,8-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazin-3-yl]methyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 167018824 |
| Molecular Formula | C18H26N6O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2R)-2-amino-N-[[(6S)-6-(anilinocarbamoyl)-4-oxo-8a-sulfanyl-3,6,7,8-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazin-3-yl]methyl]-2-(methylamino)acetamide |
| SMILES | CN[C@@H](N)C(=O)NCC1COC2(S)CC[C@@H](C(=O)NNc3ccccc3)N2C1=O |
| InChI | InChI=1S/C18H26N6O4S/c1-20-14(19)16(26)21-9-11-10-28-18(29)8-7-13(24(18)17(11)27)15(25)23-22-12-5-3-2-4-6-12/h2-6,11,13-14,20,22,29H,7-10,19H2,1H3,(H,21,26)(H,23,25)/t11?,13-,14+,18?/m0/s1 |
| InChIKey | WOFARXDWBGJRBM-OSGDMYBRSA-N |
| XLogP | -1.03 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|