About 3-aminobenzonitrile
3-aminobenzonitrile (PubChem CID 16702) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 3-aminobenzonitrile.
Molecular Properties
| Compound Name | 3-aminobenzonitrile |
| PubChem CID | 16702 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 3-aminobenzonitrile |
| SMILES | N#Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2 |
| InChIKey | NJXPYZHXZZCTNI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzonitrile?
The IUPAC name of 3-aminobenzonitrile (CID 16702) is 3-aminobenzonitrile.
What is the SMILES notation for 3-aminobenzonitrile?
The canonical SMILES for 3-aminobenzonitrile is N#Cc1cccc(N)c1.
What is the InChIKey of 3-aminobenzonitrile?
The InChIKey is NJXPYZHXZZCTNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2.
What are the key properties of 3-aminobenzonitrile?
3-aminobenzonitrile has a molecular weight of 118.14 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzonitrile is sourced from PubChem (CID 16702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).