C17H30O — CID 167020153
(3S,3aS,5R,8S)-5-tert-butyl-3,3a,8-trimethyl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one (PubChem CID 167020153) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (3S,3aS,5R,8S)-5-tert-butyl-3,3a,8-trimethyl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one.
| Compound Name | (3S,3aS,5R,8S)-5-tert-butyl-3,3a,8-trimethyl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one |
|---|---|
| PubChem CID | 167020153 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (3S,3aS,5R,8S)-5-tert-butyl-3,3a,8-trimethyl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one |
| SMILES | C[C@H]1CC[C@@H](C(C)(C)C)C[C@]2(C)C1C(=O)C[C@@H]2C |
| InChI | InChI=1S/C17H30O/c1-11-7-8-13(16(3,4)5)10-17(6)12(2)9-14(18)15(11)17/h11-13,15H,7-10H2,1-6H3/t11-,12-,13+,15?,17-/m0/s1 |
| InChIKey | PGVOQVGRQJGMKX-VLXHZYLXSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |