C38H41F3N4O3 — CID 167020280
4,6a,11,11,14b-pentamethyl-3,13-dioxo-8a-[4-[6-(trifluoromethyl)-2-pyridinyl]imidazole-1-carbonyl]-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile (PubChem CID 167020280) has the molecular formula C38H41F3N4O3 and a molecular weight of 658.77 g/mol. Its IUPAC name is 4,6a,11,11,14b-pentamethyl-3,13-dioxo-8a-[4-[6-(trifluoromethyl)-2-pyridinyl]imidazole-1-carbonyl]-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile.
| Compound Name | 4,6a,11,11,14b-pentamethyl-3,13-dioxo-8a-[4-[6-(trifluoromethyl)-2-pyridinyl]imidazole-1-carbonyl]-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 167020280 |
| Molecular Formula | C38H41F3N4O3 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 4,6a,11,11,14b-pentamethyl-3,13-dioxo-8a-[4-[6-(trifluoromethyl)-2-pyridinyl]imidazole-1-carbonyl]-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile |
| SMILES | CC1C(=O)C(C#N)=CC2(C)C3=CC(=O)C4C(CCC5(C(=O)n6cnc(-c7cccc(C(F)(F)F)n7)c6)CCC(C)(C)CC45)C3(C)CCC12 |
| InChI | InChI=1S/C38H41F3N4O3/c1-21-23-9-11-35(4)24-10-12-37(33(48)45-19-27(43-20-45)26-7-6-8-30(44-26)38(39,40)41)14-13-34(2,3)17-25(37)31(24)28(46)15-29(35)36(23,5)16-22(18-42)32(21)47/h6-8,15-16,19-21,23-25,31H,9-14,17H2,1-5H3 |
| InChIKey | JWTJMMBIRATOOY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 105.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |