C9H8N2OS — CID 167020529
7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-amine (PubChem CID 167020529) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-amine.
| Compound Name | 7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 167020529 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-amine |
| SMILES | Nc1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C9H8N2OS/c10-9-11-8-5-3-4-12-6(5)1-2-7(8)13-9/h1-2H,3-4H2,(H2,10,11) |
| InChIKey | BMZVHJFNMFGPDR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |