C17H18N4O3S — CID 167020531
5-cyclopropyl-3-([1,3]dioxolo[4,5-e][1,3]benzothiazol-7-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 167020531) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-cyclopropyl-3-([1,3]dioxolo[4,5-e][1,3]benzothiazol-7-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | 5-cyclopropyl-3-([1,3]dioxolo[4,5-e][1,3]benzothiazol-7-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 167020531 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-cyclopropyl-3-([1,3]dioxolo[4,5-e][1,3]benzothiazol-7-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | O=C1NC2CCN(C3CC3)CC2N1c1nc2c3c(ccc2s1)OCO3 |
| InChI | InChI=1S/C17H18N4O3S/c22-16-18-10-5-6-20(9-1-2-9)7-11(10)21(16)17-19-14-13(25-17)4-3-12-15(14)24-8-23-12/h3-4,9-11H,1-2,5-8H2,(H,18,22) |
| InChIKey | SNCBGUTWHOBQCB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |