C16H21Cl — CID 167021276
1-chloro-3-methyl-5-[2-[(E)-prop-1-enyl]cyclohexyl]benzene (PubChem CID 167021276) has the molecular formula C16H21Cl and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-chloro-3-methyl-5-[2-[(E)-prop-1-enyl]cyclohexyl]benzene.
| Compound Name | 1-chloro-3-methyl-5-[2-[(E)-prop-1-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 167021276 |
| Molecular Formula | C16H21Cl |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-chloro-3-methyl-5-[2-[(E)-prop-1-enyl]cyclohexyl]benzene |
| SMILES | C/C=C/C1CCCCC1c1cc(C)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl/c1-3-6-13-7-4-5-8-16(13)14-9-12(2)10-15(17)11-14/h3,6,9-11,13,16H,4-5,7-8H2,1-2H3/b6-3+ |
| InChIKey | ZJWZAOMVPXRIPF-ZZXKWVIFSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|