About (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane
(4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane (PubChem CID 167021546) has the molecular formula C17H28N2S
and a molecular weight of 292.49 g/mol. Its IUPAC name is (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane.
Molecular Properties
| Compound Name | (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane |
| PubChem CID | 167021546 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane |
| SMILES | Cc1ccnc2c1ccn2S(C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H28N2S/c1-12(2)20(13(3)4,14(5)6)19-11-9-16-15(7)8-10-18-17(16)19/h8-14H,1-7H3 |
| InChIKey | WYYALNDQGTVOCN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The IUPAC name of (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane (CID 167021546) is (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane.
What is the SMILES notation for (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The canonical SMILES for (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane is Cc1ccnc2c1ccn2S(C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane?
The InChIKey is WYYALNDQGTVOCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2S/c1-12(2)20(13(3)4,14(5)6)19-11-9-16-15(7)8-10-18-17(16)19/h8-14H,1-7H3.
What are the key properties of (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane?
(4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane has a molecular weight of 292.49 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)-λ4-sulfane is sourced from PubChem (CID 167021546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).