C9H9F — CID 167021732
(3Z,5E)-3-ethynyl-5-fluorohepta-1,3,5-triene (PubChem CID 167021732) has the molecular formula C9H9F and a molecular weight of 136.17 g/mol. Its IUPAC name is (3Z,5E)-3-ethynyl-5-fluorohepta-1,3,5-triene.
| Compound Name | (3Z,5E)-3-ethynyl-5-fluorohepta-1,3,5-triene |
|---|---|
| PubChem CID | 167021732 |
| Molecular Formula | C9H9F |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (3Z,5E)-3-ethynyl-5-fluorohepta-1,3,5-triene |
| SMILES | C#C/C(C=C)=C\C(F)=C/C |
| InChI | InChI=1S/C9H9F/c1-4-8(5-2)7-9(10)6-3/h1,5-7H,2H2,3H3/b8-7+,9-6+ |
| InChIKey | ZIPQVKNCADYRDC-KHHFIZIMSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|