C13H13F — CID 167021755
(6Z,8E)-4-ethynyl-8-fluoro-5-methylidenedeca-2,3,6,8-tetraene (PubChem CID 167021755) has the molecular formula C13H13F and a molecular weight of 188.25 g/mol. Its IUPAC name is (6Z,8E)-4-ethynyl-8-fluoro-5-methylidenedeca-2,3,6,8-tetraene.
| Compound Name | (6Z,8E)-4-ethynyl-8-fluoro-5-methylidenedeca-2,3,6,8-tetraene |
|---|---|
| PubChem CID | 167021755 |
| Molecular Formula | C13H13F |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (6Z,8E)-4-ethynyl-8-fluoro-5-methylidenedeca-2,3,6,8-tetraene |
| SMILES | C#CC(=C=CC)C(=C)/C=C\C(F)=C/C |
| InChI | InChI=1S/C13H13F/c1-5-8-12(6-2)11(4)9-10-13(14)7-3/h2,5,7,9-10H,4H2,1,3H3/b10-9-,13-7+ |
| InChIKey | OGCVJVNYRYWEQY-QLNUPNCESA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|