About 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine
2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine (PubChem CID 167021779) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine |
| PubChem CID | 167021779 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine |
| SMILES | CC=CCC(CC)CC1N=CC=NC1C |
| InChI | InChI=1S/C13H22N2/c1-4-6-7-12(5-2)10-13-11(3)14-8-9-15-13/h4,6,8-9,11-13H,5,7,10H2,1-3H3 |
| InChIKey | WQVMJXGHACBVDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine?
The IUPAC name of 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine (CID 167021779) is 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine.
What is the SMILES notation for 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine?
The canonical SMILES for 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine is CC=CCC(CC)CC1N=CC=NC1C.
What is the InChIKey of 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine?
The InChIKey is WQVMJXGHACBVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-4-6-7-12(5-2)10-13-11(3)14-8-9-15-13/h4,6,8-9,11-13H,5,7,10H2,1-3H3.
What are the key properties of 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine?
2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine has a molecular weight of 206.33 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylhex-4-enyl)-3-methyl-2,3-dihydropyrazine is sourced from PubChem (CID 167021779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).