C43H82N2 — CID 167023027
(15Z,18Z)-N,N-dimethyl-6-[8-[[(Z)-non-3-enylidene]amino]octyl]tetracosa-15,18-dien-1-amine (PubChem CID 167023027) has the molecular formula C43H82N2 and a molecular weight of 627.14 g/mol. Its IUPAC name is (15Z,18Z)-N,N-dimethyl-6-[8-[[(Z)-non-3-enylidene]amino]octyl]tetracosa-15,18-dien-1-amine.
| Compound Name | (15Z,18Z)-N,N-dimethyl-6-[8-[[(Z)-non-3-enylidene]amino]octyl]tetracosa-15,18-dien-1-amine |
|---|---|
| PubChem CID | 167023027 |
| Molecular Formula | C43H82N2 |
| Molecular Weight | 627.14 g/mol |
| Exact Mass | 626.65 |
| IUPAC Name | (15Z,18Z)-N,N-dimethyl-6-[8-[[(Z)-non-3-enylidene]amino]octyl]tetracosa-15,18-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/N=C/C/C=C\CCCCC)CCCCCN(C)C |
| InChI | InChI=1S/C43H82N2/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-22-26-31-37-43(39-33-30-36-42-45(3)4)38-32-27-23-25-29-35-41-44-40-34-28-24-12-10-8-6-2/h13-14,16-17,24,28,40,43H,5-12,15,18-23,25-27,29-39,41-42H2,1-4H3/b14-13-,17-16-,28-24-,44-40+ |
| InChIKey | QGVOCCQIHTUNMJ-PDHJYRGGSA-N |
| XLogP | 14.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.14 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|