About 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine
5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine (PubChem CID 167023305) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine |
| PubChem CID | 167023305 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine |
| SMILES | C=C(/C=C(\C)CSC)C1=CC(C)=CNC1 |
| InChI | InChI=1S/C13H19NS/c1-10-6-13(8-14-7-10)12(3)5-11(2)9-15-4/h5-7,14H,3,8-9H2,1-2,4H3/b11-5+ |
| InChIKey | VOSSRYNKHBFXBQ-VZUCSPMQSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine?
The IUPAC name of 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine (CID 167023305) is 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine.
What is the SMILES notation for 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine?
The canonical SMILES for 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine is C=C(/C=C(\C)CSC)C1=CC(C)=CNC1.
What is the InChIKey of 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine?
The InChIKey is VOSSRYNKHBFXBQ-VZUCSPMQSA-N. The full InChI is InChI=1S/C13H19NS/c1-10-6-13(8-14-7-10)12(3)5-11(2)9-15-4/h5-7,14H,3,8-9H2,1-2,4H3/b11-5+.
What are the key properties of 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine?
5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine has a molecular weight of 221.37 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-[(3E)-4-methyl-5-methylsulfanylpenta-1,3-dien-2-yl]-1,2-dihydropyridine is sourced from PubChem (CID 167023305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).