C29H31N9O5 — CID 167023349
methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanoate (PubChem CID 167023349) has the molecular formula C29H31N9O5 and a molecular weight of 585.63 g/mol. Its IUPAC name is methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 167023349 |
| Molecular Formula | C29H31N9O5 |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN1C(=O)c2cc(N)ccc2C1O)NC(=O)c1ccc(CCc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C29H31N9O5/c1-43-28(42)21(3-2-12-38-26(40)19-11-9-17(30)13-20(19)27(38)41)35-25(39)16-7-4-15(5-8-16)6-10-18-14-33-24-22(34-18)23(31)36-29(32)37-24/h4-5,7-9,11,13-14,21,26,40H,2-3,6,10,12,30H2,1H3,(H,35,39)(H4,31,32,33,36,37)/t21-,26?/m0/s1 |
| InChIKey | DSSDQYCGDKVOAZ-GVNKFJBHSA-N |
| XLogP | 1.15 |
| TPSA | 225.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|