C29H30N10O6 — CID 167023363
methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoate (PubChem CID 167023363) has the molecular formula C29H30N10O6 and a molecular weight of 614.62 g/mol. Its IUPAC name is methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 167023363 |
| Molecular Formula | C29H30N10O6 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | methyl (2S)-5-(5-amino-1-hydroxy-3-oxo-1H-isoindol-2-yl)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN1C(=O)c2cc(N)ccc2C1O)NC(=O)c1ccc(N(C=O)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C29H30N10O6/c1-45-28(44)21(3-2-10-39-26(42)19-9-6-16(30)11-20(19)27(39)43)35-25(41)15-4-7-18(8-5-15)38(14-40)13-17-12-33-24-22(34-17)23(31)36-29(32)37-24/h4-9,11-12,14,21,26,42H,2-3,10,13,30H2,1H3,(H,35,41)(H4,31,32,33,36,37)/t21-,26?/m0/s1 |
| InChIKey | FRZQLEAFULEUOO-GVNKFJBHSA-N |
| XLogP | 0.53 |
| TPSA | 245.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|