About 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine
4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine (PubChem CID 167023846) has the molecular formula C15H24ClNOS
and a molecular weight of 301.88 g/mol. Its IUPAC name is 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine.
Molecular Properties
| Compound Name | 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine |
| PubChem CID | 167023846 |
| Molecular Formula | C15H24ClNOS |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine |
| SMILES | COCCc1cc(Cl)sc1C1(C)CC(C)NC(C)C1 |
| InChI | InChI=1S/C15H24ClNOS/c1-10-8-15(3,9-11(2)17-10)14-12(5-6-18-4)7-13(16)19-14/h7,10-11,17H,5-6,8-9H2,1-4H3 |
| InChIKey | DNOZGQXELFXFMI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine?
The IUPAC name of 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine (CID 167023846) is 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine.
What is the SMILES notation for 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine?
The canonical SMILES for 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine is COCCc1cc(Cl)sc1C1(C)CC(C)NC(C)C1.
What is the InChIKey of 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine?
The InChIKey is DNOZGQXELFXFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClNOS/c1-10-8-15(3,9-11(2)17-10)14-12(5-6-18-4)7-13(16)19-14/h7,10-11,17H,5-6,8-9H2,1-4H3.
What are the key properties of 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine?
4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine has a molecular weight of 301.88 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-2,4,6-trimethylpiperidine is sourced from PubChem (CID 167023846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).