About 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine
2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine (PubChem CID 167023854) has the molecular formula C18H30ClNOS
and a molecular weight of 343.96 g/mol. Its IUPAC name is 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine |
| PubChem CID | 167023854 |
| Molecular Formula | C18H30ClNOS |
| Molecular Weight | 343.96 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine |
| SMILES | CCCCC1CC(C)(c2sc(Cl)cc2CCOC)CC(C)N1 |
| InChI | InChI=1S/C18H30ClNOS/c1-5-6-7-15-12-18(3,11-13(2)20-15)17-14(8-9-21-4)10-16(19)22-17/h10,13,15,20H,5-9,11-12H2,1-4H3 |
| InChIKey | IXBRKPMGMINVJI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.96 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine?
The IUPAC name of 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine (CID 167023854) is 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine.
What is the SMILES notation for 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine?
The canonical SMILES for 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine is CCCCC1CC(C)(c2sc(Cl)cc2CCOC)CC(C)N1.
What is the InChIKey of 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine?
The InChIKey is IXBRKPMGMINVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30ClNOS/c1-5-6-7-15-12-18(3,11-13(2)20-15)17-14(8-9-21-4)10-16(19)22-17/h10,13,15,20H,5-9,11-12H2,1-4H3.
What are the key properties of 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine?
2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine has a molecular weight of 343.96 g/mol, XLogP of 5.18, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-[5-chloro-3-(2-methoxyethyl)thiophen-2-yl]-4,6-dimethylpiperidine is sourced from PubChem (CID 167023854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).