C11H11FN2 — CID 167024945
(2S)-2-fluoro-3-methyl-1,2,3,4-tetrahydroquinoline-6-carbonitrile (PubChem CID 167024945) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is (2S)-2-fluoro-3-methyl-1,2,3,4-tetrahydroquinoline-6-carbonitrile.
| Compound Name | (2S)-2-fluoro-3-methyl-1,2,3,4-tetrahydroquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 167024945 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (2S)-2-fluoro-3-methyl-1,2,3,4-tetrahydroquinoline-6-carbonitrile |
| SMILES | CC1Cc2cc(C#N)ccc2N[C@H]1F |
| InChI | InChI=1S/C11H11FN2/c1-7-4-9-5-8(6-13)2-3-10(9)14-11(7)12/h2-3,5,7,11,14H,4H2,1H3/t7?,11-/m1/s1 |
| InChIKey | FURGDTCBVBBSBI-PLNQYNMKSA-N |
| XLogP | 2.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|