C27H33N3O2 — CID 167025270
(2R,3S,4S)-1-acetyl-2-cyclopropyl-N,3-dimethyl-4-[2-[(6-methyl-2-pyridinyl)methyl]cyclopropyl]-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 167025270) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is (2R,3S,4S)-1-acetyl-2-cyclopropyl-N,3-dimethyl-4-[2-[(6-methyl-2-pyridinyl)methyl]cyclopropyl]-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | (2R,3S,4S)-1-acetyl-2-cyclopropyl-N,3-dimethyl-4-[2-[(6-methyl-2-pyridinyl)methyl]cyclopropyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 167025270 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (2R,3S,4S)-1-acetyl-2-cyclopropyl-N,3-dimethyl-4-[2-[(6-methyl-2-pyridinyl)methyl]cyclopropyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)[C@@H](C1CC1Cc1cccc(C)n1)[C@H](C)[C@@H](C1CC1)N2C(C)=O |
| InChI | InChI=1S/C27H33N3O2/c1-15-6-5-7-21(29-15)12-20-14-22(20)25-16(2)26(18-8-9-18)30(17(3)31)24-11-10-19(13-23(24)25)27(32)28-4/h5-7,10-11,13,16,18,20,22,25-26H,8-9,12,14H2,1-4H3,(H,28,32)/t16-,20?,22?,25+,26-/m0/s1 |
| InChIKey | ASMJHMRWQIBTFO-VFFXMNSJSA-N |
| XLogP | 4.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |