C14H23FN2 — CID 167025559
1-[(2Z,4Z)-3-fluoro-5-methylhepta-2,4,6-trien-2-yl]-N-methylpiperidin-4-amine (PubChem CID 167025559) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-[(2Z,4Z)-3-fluoro-5-methylhepta-2,4,6-trien-2-yl]-N-methylpiperidin-4-amine.
| Compound Name | 1-[(2Z,4Z)-3-fluoro-5-methylhepta-2,4,6-trien-2-yl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 167025559 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(2Z,4Z)-3-fluoro-5-methylhepta-2,4,6-trien-2-yl]-N-methylpiperidin-4-amine |
| SMILES | C=C/C(C)=C\C(F)=C(/C)N1CCC(NC)CC1 |
| InChI | InChI=1S/C14H23FN2/c1-5-11(2)10-14(15)12(3)17-8-6-13(16-4)7-9-17/h5,10,13,16H,1,6-9H2,2-4H3/b11-10-,14-12- |
| InChIKey | NCFPBFGRPLAWLQ-QDUUWUCGSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|