About 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane
1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane (PubChem CID 167025576) has the molecular formula C12H25FN2
and a molecular weight of 216.34 g/mol. Its IUPAC name is 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane |
| PubChem CID | 167025576 |
| Molecular Formula | C12H25FN2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane |
| SMILES | CC1(C)CN(CF)CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25FN2/c1-11(2,3)15-7-6-14(10-13)8-12(4,5)9-15/h6-10H2,1-5H3 |
| InChIKey | NMVUUXOMVJWCPF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane?
The IUPAC name of 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane (CID 167025576) is 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane.
What is the SMILES notation for 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane?
The canonical SMILES for 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane is CC1(C)CN(CF)CCN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane?
The InChIKey is NMVUUXOMVJWCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25FN2/c1-11(2,3)15-7-6-14(10-13)8-12(4,5)9-15/h6-10H2,1-5H3.
What are the key properties of 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane?
1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane has a molecular weight of 216.34 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(fluoromethyl)-6,6-dimethyl-1,4-diazepane is sourced from PubChem (CID 167025576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).