C17H29FN2 — CID 167025868
1-[(3Z,5Z)-7-fluoro-3,5-dimethylocta-3,5,7-trien-2-yl]-N,N-dimethylpiperidin-4-amine (PubChem CID 167025868) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-[(3Z,5Z)-7-fluoro-3,5-dimethylocta-3,5,7-trien-2-yl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(3Z,5Z)-7-fluoro-3,5-dimethylocta-3,5,7-trien-2-yl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 167025868 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 1-[(3Z,5Z)-7-fluoro-3,5-dimethylocta-3,5,7-trien-2-yl]-N,N-dimethylpiperidin-4-amine |
| SMILES | C=C(F)/C=C(C)\C=C(\C)C(C)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C17H29FN2/c1-13(12-15(3)18)11-14(2)16(4)20-9-7-17(8-10-20)19(5)6/h11-12,16-17H,3,7-10H2,1-2,4-6H3/b13-12-,14-11- |
| InChIKey | QDMXYRGFECZULC-NIHAPQRKSA-N |
| XLogP | 3.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|