C29H24N2O4 — CID 167025995
phenyl 3-[8-(3-oxo-3-phenoxypropyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]propanoate (PubChem CID 167025995) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is phenyl 3-[8-(3-oxo-3-phenoxypropyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]propanoate.
| Compound Name | phenyl 3-[8-(3-oxo-3-phenoxypropyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]propanoate |
|---|---|
| PubChem CID | 167025995 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | phenyl 3-[8-(3-oxo-3-phenoxypropyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]propanoate |
| SMILES | O=C(CCC1(CCC(=O)Oc2ccccc2)c2cccnc2-c2ncccc21)Oc1ccccc1 |
| InChI | InChI=1S/C29H24N2O4/c32-25(34-21-9-3-1-4-10-21)15-17-29(18-16-26(33)35-22-11-5-2-6-12-22)23-13-7-19-30-27(23)28-24(29)14-8-20-31-28/h1-14,19-20H,15-18H2 |
| InChIKey | KSQZUFGHJOOBCS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|