C30H21N3O4 — CID 167025998
phenyl 2-[17-(2-oxo-2-phenoxyethyl)-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-17-yl]acetate (PubChem CID 167025998) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is phenyl 2-[17-(2-oxo-2-phenoxyethyl)-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-17-yl]acetate.
| Compound Name | phenyl 2-[17-(2-oxo-2-phenoxyethyl)-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-17-yl]acetate |
|---|---|
| PubChem CID | 167025998 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | phenyl 2-[17-(2-oxo-2-phenoxyethyl)-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-17-yl]acetate |
| SMILES | O=C(CC1(CC(=O)Oc2ccccc2)c2cccnc2-c2nc3ccccc3nc21)Oc1ccccc1 |
| InChI | InChI=1S/C30H21N3O4/c34-25(36-20-10-3-1-4-11-20)18-30(19-26(35)37-21-12-5-2-6-13-21)22-14-9-17-31-27(22)28-29(30)33-24-16-8-7-15-23(24)32-28/h1-17H,18-19H2 |
| InChIKey | HFMBOPRXAIAPNP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|