About (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine
(2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine (PubChem CID 167026065) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine |
| PubChem CID | 167026065 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine |
| SMILES | CC[C@H]1CC[C@@H](C2(C)C=CC(F)=CC2)N1 |
| InChI | InChI=1S/C13H20FN/c1-3-11-4-5-12(15-11)13(2)8-6-10(14)7-9-13/h6-8,11-12,15H,3-5,9H2,1-2H3/t11-,12-,13?/m0/s1 |
| InChIKey | LKCXNZXLIBEMTQ-VYAYZGMFSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The IUPAC name of (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine (CID 167026065) is (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine.
What is the SMILES notation for (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The canonical SMILES for (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine is CC[C@H]1CC[C@@H](C2(C)C=CC(F)=CC2)N1.
What is the InChIKey of (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The InChIKey is LKCXNZXLIBEMTQ-VYAYZGMFSA-N. The full InChI is InChI=1S/C13H20FN/c1-3-11-4-5-12(15-11)13(2)8-6-10(14)7-9-13/h6-8,11-12,15H,3-5,9H2,1-2H3/t11-,12-,13?/m0/s1.
What are the key properties of (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
(2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine has a molecular weight of 209.31 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2-ethyl-5-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine is sourced from PubChem (CID 167026065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).