About ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate
ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate (PubChem CID 167026191) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate |
| PubChem CID | 167026191 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate |
| SMILES | CCOC(=O)CC1(CC(=O)OCC)C2=CCCC=C2c2ncccc21 |
| InChI | InChI=1S/C20H23NO4/c1-3-24-17(22)12-20(13-18(23)25-4-2)15-9-6-5-8-14(15)19-16(20)10-7-11-21-19/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | SZPSVWPCUOPXRA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate?
The IUPAC name of ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate (CID 167026191) is ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate.
What is the SMILES notation for ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate?
The canonical SMILES for ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate is CCOC(=O)CC1(CC(=O)OCC)C2=CCCC=C2c2ncccc21.
What is the InChIKey of ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate?
The InChIKey is SZPSVWPCUOPXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-3-24-17(22)12-20(13-18(23)25-4-2)15-9-6-5-8-14(15)19-16(20)10-7-11-21-19/h7-11H,3-6,12-13H2,1-2H3.
What are the key properties of ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate?
ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate has a molecular weight of 341.41 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-(2-ethoxy-2-oxoethyl)-7,8-dihydroindeno[1,2-b]pyridin-5-yl]acetate is sourced from PubChem (CID 167026191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).