C17H24FNO3 — CID 167026323
tert-butyl (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-formylpyrrolidine-1-carboxylate (PubChem CID 167026323) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167026323 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-formylpyrrolidine-1-carboxylate |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H]1CC[C@H](C=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24FNO3/c1-6-13(18)8-7-12(2)15-10-9-14(11-20)19(15)16(21)22-17(3,4)5/h6-8,11,14-15H,2,9-10H2,1,3-5H3/b8-7-,13-6+/t14-,15+/m1/s1 |
| InChIKey | SMQVSLOSJPBAPY-LSEZHIFWSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|