C13H20FNO — CID 167026339
(2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-(methoxymethyl)pyrrolidine (PubChem CID 167026339) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-(methoxymethyl)pyrrolidine.
| Compound Name | (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 167026339 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2S,5R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-(methoxymethyl)pyrrolidine |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H]1CC[C@H](COC)N1 |
| InChI | InChI=1S/C13H20FNO/c1-4-11(14)6-5-10(2)13-8-7-12(15-13)9-16-3/h4-6,12-13,15H,2,7-9H2,1,3H3/b6-5-,11-4+/t12-,13+/m1/s1 |
| InChIKey | XLHHHPWMAKSSTL-LUJMXRORSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|